C27H24O — CID 134957573
(1R)-1-benzyl-3-methyl-1-[(E)-3-phenylprop-2-enyl]naphthalen-2-one (PubChem CID 134957573) has the molecular formula C27H24O and a molecular weight of 364.49 g/mol. Its IUPAC name is (1R)-1-benzyl-3-methyl-1-[(E)-3-phenylprop-2-enyl]naphthalen-2-one.
| Compound Name | (1R)-1-benzyl-3-methyl-1-[(E)-3-phenylprop-2-enyl]naphthalen-2-one |
|---|---|
| PubChem CID | 134957573 |
| Molecular Formula | C27H24O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (1R)-1-benzyl-3-methyl-1-[(E)-3-phenylprop-2-enyl]naphthalen-2-one |
| SMILES | CC1=Cc2ccccc2[C@@](C/C=C/c2ccccc2)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H24O/c1-21-19-24-16-8-9-17-25(24)27(26(21)28,20-23-13-6-3-7-14-23)18-10-15-22-11-4-2-5-12-22/h2-17,19H,18,20H2,1H3/b15-10+/t27-/m1/s1 |
| InChIKey | GMIULIQNHFDTDV-UDKPXMKSSA-N |
| XLogP | 6.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |