C11H27NP2Se2 — CID 11234759
N,N-bis(diethylphosphinoselenoyl)propan-1-amine (PubChem CID 11234759) has the molecular formula C11H27NP2Se2 and a molecular weight of 393.21 g/mol. Its IUPAC name is N,N-bis(diethylphosphinoselenoyl)propan-1-amine.
| Compound Name | N,N-bis(diethylphosphinoselenoyl)propan-1-amine |
|---|---|
| PubChem CID | 11234759 |
| Molecular Formula | C11H27NP2Se2 |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | N,N-bis(diethylphosphinoselenoyl)propan-1-amine |
| SMILES | CCCN(P(=[Se])(CC)CC)P(=[Se])(CC)CC |
| InChI | InChI=1S/C11H27NP2Se2/c1-6-11-12(13(15,7-2)8-3)14(16,9-4)10-5/h6-11H2,1-5H3 |
| InChIKey | RLAYVCVHJUFXEQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|