C15H19IO3 — CID 11235289
1-(4,4-diethoxybut-2-ynoxy)-2-(iodomethyl)benzene (PubChem CID 11235289) has the molecular formula C15H19IO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is 1-(4,4-diethoxybut-2-ynoxy)-2-(iodomethyl)benzene.
| Compound Name | 1-(4,4-diethoxybut-2-ynoxy)-2-(iodomethyl)benzene |
|---|---|
| PubChem CID | 11235289 |
| Molecular Formula | C15H19IO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-(4,4-diethoxybut-2-ynoxy)-2-(iodomethyl)benzene |
| SMILES | CCOC(C#CCOc1ccccc1CI)OCC |
| InChI | InChI=1S/C15H19IO3/c1-3-17-15(18-4-2)10-7-11-19-14-9-6-5-8-13(14)12-16/h5-6,8-9,15H,3-4,11-12H2,1-2H3 |
| InChIKey | QZSMQADYETVMFC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|