C20H18F2N4O2S — CID 11235400
(2S)-N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide (PubChem CID 11235400) has the molecular formula C20H18F2N4O2S and a molecular weight of 416.45 g/mol. Its IUPAC name is (2S)-N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 11235400 |
| Molecular Formula | C20H18F2N4O2S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (2S)-N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1nc(-c2ccc(N)cc2)cs1 |
| InChI | InChI=1S/C20H18F2N4O2S/c1-11(24-18(27)8-12-6-14(21)9-15(22)7-12)19(28)26-20-25-17(10-29-20)13-2-4-16(23)5-3-13/h2-7,9-11H,8,23H2,1H3,(H,24,27)(H,25,26,28)/t11-/m0/s1 |
| InChIKey | LFNWOZJZQUQPML-NSHDSACASA-N |
| XLogP | 3.36 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|