C26H48O3Si — CID 11235942
ethyl (E)-8-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]oct-2-enoate (PubChem CID 11235942) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is ethyl (E)-8-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]oct-2-enoate.
| Compound Name | ethyl (E)-8-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]oct-2-enoate |
|---|---|
| PubChem CID | 11235942 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | ethyl (E)-8-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-pent-2-enyl]cyclopentyl]oct-2-enoate |
| SMILES | CC/C=C\C[C@H]1[C@@H](CCCCC/C=C/C(=O)OCC)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-8-10-14-18-23-22(17-15-12-11-13-16-19-25(27)28-9-2)20-21-24(23)29-30(6,7)26(3,4)5/h10,14,16,19,22-24H,8-9,11-13,15,17-18,20-21H2,1-7H3/b14-10-,19-16+/t22-,23-,24+/m0/s1 |
| InChIKey | URKZKWGDCOOCHT-YYHGNGDCSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|