C28H35NO6 — CID 11237008
5-[(1-benzylpiperidin-4-yl)methyl]-5-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 11237008) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is 5-[(1-benzylpiperidin-4-yl)methyl]-5-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(1-benzylpiperidin-4-yl)methyl]-5-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11237008 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 5-[(1-benzylpiperidin-4-yl)methyl]-5-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(CC2(CC3CCN(Cc4ccccc4)CC3)C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C28H35NO6/c1-27(2)34-25(30)28(26(31)35-27,18-22-10-11-23(32-3)24(16-22)33-4)17-20-12-14-29(15-13-20)19-21-8-6-5-7-9-21/h5-11,16,20H,12-15,17-19H2,1-4H3 |
| InChIKey | SPUWBZAGLMIYKB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|