C35H41N7O3 — CID 11238836
(2S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid (PubChem CID 11238836) has the molecular formula C35H41N7O3 and a molecular weight of 607.76 g/mol. Its IUPAC name is (2S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 11238836 |
| Molecular Formula | C35H41N7O3 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | (2S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1c[nH]c2ccc(O)cc12)NCc1ccc(CN(CCNCc2ccccn2)CCNCc2ccccn2)cc1 |
| InChI | InChI=1S/C35H41N7O3/c43-31-11-12-33-32(20-31)28(22-41-33)19-34(35(44)45)40-21-26-7-9-27(10-8-26)25-42(17-15-36-23-29-5-1-3-13-38-29)18-16-37-24-30-6-2-4-14-39-30/h1-14,20,22,34,36-37,40-41,43H,15-19,21,23-25H2,(H,44,45)/t34-/m0/s1 |
| InChIKey | PPXJJIZNNKAVQW-UMSFTDKQSA-N |
| XLogP | 3.83 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|