C33H42N6O2 — CID 59750951
(1S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-1-phenylpropane-1,3-diol (PubChem CID 59750951) has the molecular formula C33H42N6O2 and a molecular weight of 554.74 g/mol. Its IUPAC name is (1S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-1-phenylpropane-1,3-diol.
| Compound Name | (1S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 59750951 |
| Molecular Formula | C33H42N6O2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | (1S)-2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-1-phenylpropane-1,3-diol |
| SMILES | OCC(NCc1ccc(CN(CCNCc2ccccn2)CCNCc2ccccn2)cc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C33H42N6O2/c40-26-32(33(41)29-8-2-1-3-9-29)38-22-27-12-14-28(15-13-27)25-39(20-18-34-23-30-10-4-6-16-36-30)21-19-35-24-31-11-5-7-17-37-31/h1-17,32-35,38,40-41H,18-26H2/t32?,33-/m0/s1 |
| InChIKey | RDOJYLJYGHTOJW-OBOZPERJSA-N |
| XLogP | 3.04 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|