C32H39ClN6O — CID 69176425
2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-2-(3-chlorophenyl)ethanol (PubChem CID 69176425) has the molecular formula C32H39ClN6O and a molecular weight of 559.16 g/mol. Its IUPAC name is 2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-2-(3-chlorophenyl)ethanol.
| Compound Name | 2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-2-(3-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 69176425 |
| Molecular Formula | C32H39ClN6O |
| Molecular Weight | 559.16 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylamino]-2-(3-chlorophenyl)ethanol |
| SMILES | OCC(NCc1ccc(CN(CCNCc2ccccn2)CCNCc2ccccn2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C32H39ClN6O/c33-29-7-5-6-28(20-29)32(25-40)38-21-26-10-12-27(13-11-26)24-39(18-16-34-22-30-8-1-3-14-36-30)19-17-35-23-31-9-2-4-15-37-31/h1-15,20,32,34-35,38,40H,16-19,21-25H2 |
| InChIKey | ZSZDQDWYLNAKJS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|