C30H34N8O — CID 72551634
N-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 72551634) has the molecular formula C30H34N8O and a molecular weight of 522.66 g/mol. Its IUPAC name is N-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 72551634 |
| Molecular Formula | C30H34N8O |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | N-[[4-[[bis[2-(pyridin-2-ylmethylamino)ethyl]amino]methyl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(CN(CCNCc2ccccn2)CCNCc2ccccn2)cc1)c1ccncc1 |
| InChI | InChI=1S/C30H34N8O/c39-30(27-11-15-31-16-12-27)37-36-21-25-7-9-26(10-8-25)24-38(19-17-32-22-28-5-1-3-13-34-28)20-18-33-23-29-6-2-4-14-35-29/h1-16,21,32-33H,17-20,22-24H2,(H,37,39) |
| InChIKey | JPVCKAPGCVUSLK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|