C5H3ClN4 — CID 11240611
6-chloro-[1,2,4]triazolo[1,5-b]pyridazine (PubChem CID 11240611) has the molecular formula C5H3ClN4 and a molecular weight of 154.56 g/mol. Its IUPAC name is 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine.
| Compound Name | 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 11240611 |
| Molecular Formula | C5H3ClN4 |
| Molecular Weight | 154.56 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 6-chloro-[1,2,4]triazolo[1,5-b]pyridazine |
| SMILES | Clc1ccc2ncnn2n1 |
| InChI | InChI=1S/C5H3ClN4/c6-4-1-2-5-7-3-8-10(5)9-4/h1-3H |
| InChIKey | AKAGLBBCCXXHAA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.56 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |