C12H16O5 — CID 11241916
(2R)-2-[(2R)-2-hydroxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one (PubChem CID 11241916) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-hydroxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2R)-2-hydroxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11241916 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2R)-2-[(2R)-2-hydroxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
| SMILES | C#CC[C@@H](O)C[C@@H]1CC(OCOC)=CC(=O)O1 |
| InChI | InChI=1S/C12H16O5/c1-3-4-9(13)5-11-6-10(16-8-15-2)7-12(14)17-11/h1,7,9,11,13H,4-6,8H2,2H3/t9-,11-/m1/s1 |
| InChIKey | COEYUQYWKBUJNG-MWLCHTKSSA-N |
| XLogP | 0.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|