C19H32O5Si — CID 11199485
6-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11199485) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is 6-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11199485 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 6-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C#CC[C@H](CC(O)CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O5Si/c1-9-10-15(24-25(7,8)18(2,3)4)11-14(20)12-16-13-17(21)23-19(5,6)22-16/h1,13-15,20H,10-12H2,2-8H3/t14?,15-/m1/s1 |
| InChIKey | OXUDRAKJXQPMLN-YSSOQSIOSA-N |
| XLogP | 3.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|