C22H42O6Si — CID 71745593
6-[(3S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methoxy-2,6-dimethylheptan-2-yl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 71745593) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is 6-[(3S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methoxy-2,6-dimethylheptan-2-yl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(3S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methoxy-2,6-dimethylheptan-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 71745593 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 6-[(3S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methoxy-2,6-dimethylheptan-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CO[C@@H](C[C@H](O)C(C)(C)C1=CC(=O)OC(C)(C)O1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O6Si/c1-15(14-26-29(10,11)20(2,3)4)16(25-9)12-17(23)21(5,6)18-13-19(24)28-22(7,8)27-18/h13,15-17,23H,12,14H2,1-11H3/t15-,16-,17-/m0/s1 |
| InChIKey | BPUYTSMIBFJBPE-ULQDDVLXSA-N |
| XLogP | 4.63 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|