C25H45BrO5Si2 — CID 11410415
6-[(2R,4R)-7-bromo-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11410415) has the molecular formula C25H45BrO5Si2 and a molecular weight of 561.71 g/mol. Its IUPAC name is 6-[(2R,4R)-7-bromo-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,4R)-7-bromo-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11410415 |
| Molecular Formula | C25H45BrO5Si2 |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 6-[(2R,4R)-7-bromo-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(C[C@@H](C[C@@H](CC#CBr)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H45BrO5Si2/c1-23(2,3)32(9,10)30-19(14-13-15-26)16-21(31-33(11,12)24(4,5)6)17-20-18-22(27)29-25(7,8)28-20/h18-19,21H,14,16-17H2,1-12H3/t19-,21-/m1/s1 |
| InChIKey | YFAPIDKUWGDWEX-TZIWHRDSSA-N |
| XLogP | 7.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|