C18H30O5Si — CID 11314225
(2R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one (PubChem CID 11314225) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11314225 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-ynyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
| SMILES | C#CC[C@H](C[C@@H]1CC(OCOC)=CC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O5Si/c1-8-9-14(23-24(6,7)18(2,3)4)10-16-11-15(21-13-20-5)12-17(19)22-16/h1,12,14,16H,9-11,13H2,2-7H3/t14-,16-/m1/s1 |
| InChIKey | ZRRBPNZTTYLFRJ-GDBMZVCRSA-N |
| XLogP | 3.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|