C49H98O7Si4 — CID 56964704
6-[(2R,4S,7R,8S,10R)-10-hydroxy-7,10-dimethyl-2,4,8-tris(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 56964704) has the molecular formula C49H98O7Si4 and a molecular weight of 911.66 g/mol. Its IUPAC name is 6-[(2R,4S,7R,8S,10R)-10-hydroxy-7,10-dimethyl-2,4,8-tris(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,4S,7R,8S,10R)-10-hydroxy-7,10-dimethyl-2,4,8-tris(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 56964704 |
| Molecular Formula | C49H98O7Si4 |
| Molecular Weight | 911.66 g/mol |
| Exact Mass | 910.64 |
| IUPAC Name | 6-[(2R,4S,7R,8S,10R)-10-hydroxy-7,10-dimethyl-2,4,8-tris(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC[C@@H](C)[C@H](C[C@](C)(O)CCC#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](CC)(CC)CC)C[C@H](CC1=CC(=O)OC(C)(C)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C49H98O7Si4/c1-20-57(21-2,22-3)54-43(35-45(55-58(23-4,24-5)25-6)36-44-37-47(50)53-48(17,18)52-44)32-31-42(16)46(56-59(26-7,27-8)28-9)38-49(19,51)33-29-30-34-60(39(10)11,40(12)13)41(14)15/h37,39-43,45-46,51H,20-29,31-33,35-36,38H2,1-19H3/t42-,43+,45-,46+,49-/m1/s1 |
| InChIKey | RWZFZMWVORPWEY-OQBYSNPRSA-N |
| XLogP | 14.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.66 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|