C43H84O7Si3 — CID 56964602
6-[(2R,4S,7R,8S,10R)-2,4-dihydroxy-7,10-dimethyl-8,10-bis(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 56964602) has the molecular formula C43H84O7Si3 and a molecular weight of 797.40 g/mol. Its IUPAC name is 6-[(2R,4S,7R,8S,10R)-2,4-dihydroxy-7,10-dimethyl-8,10-bis(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,4S,7R,8S,10R)-2,4-dihydroxy-7,10-dimethyl-8,10-bis(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 56964602 |
| Molecular Formula | C43H84O7Si3 |
| Molecular Weight | 797.40 g/mol |
| Exact Mass | 796.55 |
| IUPAC Name | 6-[(2R,4S,7R,8S,10R)-2,4-dihydroxy-7,10-dimethyl-8,10-bis(triethylsilyloxy)-14-tri(propan-2-yl)silyltetradec-13-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@@](C)(CCC#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](CC)(CC)CC)[C@H](C)CC[C@H](O)C[C@@H](O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C43H84O7Si3/c1-17-51(18-2,19-3)49-40(36(13)25-26-37(44)29-38(45)30-39-31-41(46)48-42(14,15)47-39)32-43(16,50-52(20-4,21-5)22-6)27-23-24-28-53(33(7)8,34(9)10)35(11)12/h31,33-38,40,44-45H,17-23,25-27,29-30,32H2,1-16H3/t36-,37+,38-,40+,43-/m1/s1 |
| InChIKey | HZGFNBGRUJVBAV-ANTXOTEJSA-N |
| XLogP | 11.66 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.40 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|