C19H36O5Si — CID 71497611
6-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-methylhexyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 71497611) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 6-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-methylhexyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-methylhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 71497611 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 6-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-methylhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C[C@H](CCCO[Si](C)(C)C(C)(C)C)C(O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C19H36O5Si/c1-14(10-9-11-22-25(7,8)18(2,3)4)16(20)12-15-13-17(21)24-19(5,6)23-15/h13-14,16,20H,9-12H2,1-8H3/t14-,16?/m1/s1 |
| InChIKey | NDYHRWPFLFDBJZ-IURRXHLWSA-N |
| XLogP | 4.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|