C17H20N2O2 — CID 11243092
(1R,5R,7R)-8-benzyl-7-methyl-8,10-diazatricyclo[5.2.2.01,5]undecane-9,11-dione (PubChem CID 11243092) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (1R,5R,7R)-8-benzyl-7-methyl-8,10-diazatricyclo[5.2.2.01,5]undecane-9,11-dione.
| Compound Name | (1R,5R,7R)-8-benzyl-7-methyl-8,10-diazatricyclo[5.2.2.01,5]undecane-9,11-dione |
|---|---|
| PubChem CID | 11243092 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (1R,5R,7R)-8-benzyl-7-methyl-8,10-diazatricyclo[5.2.2.01,5]undecane-9,11-dione |
| SMILES | C[C@@]12C[C@H]3CCC[C@]3(NC1=O)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-16-10-13-8-5-9-17(13,18-14(16)20)15(21)19(16)11-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H,18,20)/t13-,16-,17-/m1/s1 |
| InChIKey | BIFMFOVEONHVQR-KBRIMQKVSA-N |
| XLogP | 1.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |