C17H24N2O — CID 175662479
(3aS)-4-benzyl-3a-methyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one (PubChem CID 175662479) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (3aS)-4-benzyl-3a-methyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one.
| Compound Name | (3aS)-4-benzyl-3a-methyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 175662479 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (3aS)-4-benzyl-3a-methyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
| SMILES | C[C@]12CCNC1CCCCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c1-17-11-12-18-15(17)9-5-6-10-16(20)19(17)13-14-7-3-2-4-8-14/h2-4,7-8,15,18H,5-6,9-13H2,1H3/t15?,17-/m0/s1 |
| InChIKey | HDEGIQLAGHOCNP-LWKPJOBUSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |