C16H17N3O5 — CID 11244424
methyl 4-benzamido-1-(methoxycarbonylamino)-2-methylpyrrole-3-carboxylate (PubChem CID 11244424) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is methyl 4-benzamido-1-(methoxycarbonylamino)-2-methylpyrrole-3-carboxylate.
| Compound Name | methyl 4-benzamido-1-(methoxycarbonylamino)-2-methylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11244424 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 4-benzamido-1-(methoxycarbonylamino)-2-methylpyrrole-3-carboxylate |
| SMILES | COC(=O)Nn1cc(NC(=O)c2ccccc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H17N3O5/c1-10-13(15(21)23-2)12(9-19(10)18-16(22)24-3)17-14(20)11-7-5-4-6-8-11/h4-9H,1-3H3,(H,17,20)(H,18,22) |
| InChIKey | FHXWJKGHKYWYFQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |