C16H17N3O5 — CID 11267539
dimethyl 1-amino-3-benzamido-5-methylpyrrole-2,4-dicarboxylate (PubChem CID 11267539) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is dimethyl 1-amino-3-benzamido-5-methylpyrrole-2,4-dicarboxylate.
| Compound Name | dimethyl 1-amino-3-benzamido-5-methylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11267539 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | dimethyl 1-amino-3-benzamido-5-methylpyrrole-2,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccccc2)c(C(=O)OC)n(N)c1C |
| InChI | InChI=1S/C16H17N3O5/c1-9-11(15(21)23-2)12(13(19(9)17)16(22)24-3)18-14(20)10-7-5-4-6-8-10/h4-8H,17H2,1-3H3,(H,18,20) |
| InChIKey | HWKGONVOTUCLKN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |