C19H25N5O3 — CID 11245694
N-[(2R)-2-[5-[2-(1H-benzimidazol-2-yl)ethyl]-1,3,4-oxadiazol-2-yl]heptyl]-N-hydroxyformamide (PubChem CID 11245694) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(2R)-2-[5-[2-(1H-benzimidazol-2-yl)ethyl]-1,3,4-oxadiazol-2-yl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[5-[2-(1H-benzimidazol-2-yl)ethyl]-1,3,4-oxadiazol-2-yl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11245694 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[(2R)-2-[5-[2-(1H-benzimidazol-2-yl)ethyl]-1,3,4-oxadiazol-2-yl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)c1nnc(CCc2nc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C19H25N5O3/c1-2-3-4-7-14(12-24(26)13-25)19-23-22-18(27-19)11-10-17-20-15-8-5-6-9-16(15)21-17/h5-6,8-9,13-14,26H,2-4,7,10-12H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | LPNPIUUUJNBZRI-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|