C24H29N3O3 — CID 86603578
N-[(2R)-2-(5-benzyl-1,3,4-oxadiazol-2-yl)heptyl]-N-phenylmethoxyformamide (PubChem CID 86603578) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[(2R)-2-(5-benzyl-1,3,4-oxadiazol-2-yl)heptyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R)-2-(5-benzyl-1,3,4-oxadiazol-2-yl)heptyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 86603578 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[(2R)-2-(5-benzyl-1,3,4-oxadiazol-2-yl)heptyl]-N-phenylmethoxyformamide |
| SMILES | CCCCC[C@H](CN(C=O)OCc1ccccc1)c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C24H29N3O3/c1-2-3-6-15-22(17-27(19-28)29-18-21-13-9-5-10-14-21)24-26-25-23(30-24)16-20-11-7-4-8-12-20/h4-5,7-14,19,22H,2-3,6,15-18H2,1H3/t22-/m1/s1 |
| InChIKey | IVTZHPMDXSGCHG-JOCHJYFZSA-N |
| XLogP | 4.91 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|