About 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid (PubChem CID 11245838) has the molecular formula C17H13FN2O3S2
and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid.
Molecular Properties
| Compound Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid |
| PubChem CID | 11245838 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)CCN2c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H13FN2O3S2/c18-13-3-1-11(2-4-13)15-10-24-17(19-15)20-8-7-12-9-14(25(21,22)23)5-6-16(12)20/h1-6,9-10H,7-8H2,(H,21,22,23) |
| InChIKey | BFHICHHLTCZUJT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid?
The IUPAC name of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid (CID 11245838) is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid.
What is the SMILES notation for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid?
The canonical SMILES for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid is O=S(=O)(O)c1ccc2c(c1)CCN2c1nc(-c2ccc(F)cc2)cs1.
What is the InChIKey of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid?
The InChIKey is BFHICHHLTCZUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O3S2/c18-13-3-1-11(2-4-13)15-10-24-17(19-15)20-8-7-12-9-14(25(21,22)23)5-6-16(12)20/h1-6,9-10H,7-8H2,(H,21,22,23).
What are the key properties of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid?
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid has a molecular weight of 376.43 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid is sourced from PubChem (CID 11245838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).