C17H13FN2O3S2 — CID 11245838
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid (PubChem CID 11245838) has the molecular formula C17H13FN2O3S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid.
| Compound Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid |
|---|---|
| PubChem CID | 11245838 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,3-dihydroindole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)CCN2c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H13FN2O3S2/c18-13-3-1-11(2-4-13)15-10-24-17(19-15)20-8-7-12-9-14(25(21,22)23)5-6-16(12)20/h1-6,9-10H,7-8H2,(H,21,22,23) |
| InChIKey | BFHICHHLTCZUJT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|