C25H33ClO2 — CID 11246604
[(1S,6S)-6-(4-chlorophenyl)-3,4-dimethylcyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 11246604) has the molecular formula C25H33ClO2 and a molecular weight of 400.99 g/mol. Its IUPAC name is [(1S,6S)-6-(4-chlorophenyl)-3,4-dimethylcyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,6S)-6-(4-chlorophenyl)-3,4-dimethylcyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 11246604 |
| Molecular Formula | C25H33ClO2 |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1S,6S)-6-(4-chlorophenyl)-3,4-dimethylcyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | CC1=C(C)C[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)[C@@]2(O)C[C@H]3CC[C@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C25H33ClO2/c1-15-12-20(17-6-8-19(26)9-7-17)21(13-16(15)2)22(27)25(28)14-18-10-11-24(25,5)23(18,3)4/h6-9,18,20-21,28H,10-14H2,1-5H3/t18-,20-,21+,24-,25+/m1/s1 |
| InChIKey | LSMVNKJCGYNUQT-HRDKSGGDSA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|