C19H23ClO2 — CID 11438552
(E)-3-(4-chlorophenyl)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-en-1-one (PubChem CID 11438552) has the molecular formula C19H23ClO2 and a molecular weight of 318.84 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11438552 |
| Molecular Formula | C19H23ClO2 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-en-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(C(=O)/C=C/c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C19H23ClO2/c1-17(2)14-10-11-18(17,3)19(22,12-14)16(21)9-6-13-4-7-15(20)8-5-13/h4-9,14,22H,10-12H2,1-3H3/b9-6+/t14-,18-,19+/m1/s1 |
| InChIKey | RURMPKBAUDMDKL-ALIGVQPQSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|