C17H20O3 — CID 12561995
3-benzoyl-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 12561995) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-benzoyl-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-benzoyl-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 12561995 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-benzoyl-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CCC1(C)C(O)(C(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C17H20O3/c1-15(2)12-9-10-16(15,3)17(20,14(12)19)13(18)11-7-5-4-6-8-11/h4-8,12,20H,9-10H2,1-3H3 |
| InChIKey | YYZWDNCSNSHYQR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|