C19H24O2 — CID 134841913
(E)-1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3-phenylprop-2-en-1-one (PubChem CID 134841913) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 134841913 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (E)-1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)C2CCC1(C)C(O)(C(=O)/C=C/c1ccccc1)C2 |
| InChI | InChI=1S/C19H24O2/c1-17(2)15-11-12-18(17,3)19(21,13-15)16(20)10-9-14-7-5-4-6-8-14/h4-10,15,21H,11-13H2,1-3H3/b10-9+ |
| InChIKey | DEKCYRKKVRQFJM-MDZDMXLPSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|