C17H20O2 — CID 141308160
4-benzylidene-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one (PubChem CID 141308160) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-benzylidene-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one.
| Compound Name | 4-benzylidene-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one |
|---|---|
| PubChem CID | 141308160 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 4-benzylidene-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one |
| SMILES | CC1(O)C(=O)C(=Cc2ccccc2)C2CC1C2(C)C |
| InChI | InChI=1S/C17H20O2/c1-16(2)13-10-14(16)17(3,19)15(18)12(13)9-11-7-5-4-6-8-11/h4-9,13-14,19H,10H2,1-3H3 |
| InChIKey | OYDCXFJBOSJLQF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|