C19H31ClO3SSi — CID 11246657
methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(ethylsulfanylmethyl)propanoate (PubChem CID 11246657) has the molecular formula C19H31ClO3SSi and a molecular weight of 403.06 g/mol. Its IUPAC name is methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(ethylsulfanylmethyl)propanoate.
| Compound Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(ethylsulfanylmethyl)propanoate |
|---|---|
| PubChem CID | 11246657 |
| Molecular Formula | C19H31ClO3SSi |
| Molecular Weight | 403.06 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(ethylsulfanylmethyl)propanoate |
| SMILES | CCSC[C@H](C(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H31ClO3SSi/c1-8-24-13-16(18(21)22-5)17(14-9-11-15(20)12-10-14)23-25(6,7)19(2,3)4/h9-12,16-17H,8,13H2,1-7H3/t16-,17+/m0/s1 |
| InChIKey | IIUQFJGBRJDVGU-DLBZAZTESA-N |
| XLogP | 5.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.06 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|