C25H44O3Si — CID 11247184
(2S)-2-[(1R,4aR,5R,8aS)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-7-methyl-3-oxo-2,4,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanal (PubChem CID 11247184) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (2S)-2-[(1R,4aR,5R,8aS)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-7-methyl-3-oxo-2,4,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanal.
| Compound Name | (2S)-2-[(1R,4aR,5R,8aS)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-7-methyl-3-oxo-2,4,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanal |
|---|---|
| PubChem CID | 11247184 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (2S)-2-[(1R,4aR,5R,8aS)-5-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-7-methyl-3-oxo-2,4,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanal |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](C)C=O)CC(=O)C[C@@H]2[C@H]([C@H](CO[Si](C)(C)C(C)(C)C)C(C)C)C1 |
| InChI | InChI=1S/C25H44O3Si/c1-16(2)24(15-28-29(8,9)25(5,6)7)22-11-17(3)10-21-20(18(4)14-26)12-19(27)13-23(21)22/h10,14,16,18,20-24H,11-13,15H2,1-9H3/t18-,20+,21-,22-,23+,24-/m1/s1 |
| InChIKey | PPSLZHYOZYIKOP-GBVUVUFASA-N |
| XLogP | 6.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|