C23H23NO5S — CID 11247311
methyl 3-[2-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]phenyl]prop-2-ynoate (PubChem CID 11247311) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl 3-[2-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]phenyl]prop-2-ynoate.
| Compound Name | methyl 3-[2-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]phenyl]prop-2-ynoate |
|---|---|
| PubChem CID | 11247311 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | methyl 3-[2-[3,6-dihydro-2H-pyran-4-ylmethyl-(4-methylphenyl)sulfonylamino]phenyl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1ccccc1N(CC1=CCOCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-18-7-10-21(11-8-18)30(26,27)24(17-19-13-15-29-16-14-19)22-6-4-3-5-20(22)9-12-23(25)28-2/h3-8,10-11,13H,14-17H2,1-2H3 |
| InChIKey | ZZWOAKUTNQMFDA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|