C13H13F11O4 — CID 11247709
2-but-3-enoxypropyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 11247709) has the molecular formula C13H13F11O4 and a molecular weight of 442.22 g/mol. Its IUPAC name is 2-but-3-enoxypropyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | 2-but-3-enoxypropyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 11247709 |
| Molecular Formula | C13H13F11O4 |
| Molecular Weight | 442.22 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-but-3-enoxypropyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | C=CCCOC(C)COC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F11O4/c1-3-4-5-26-7(2)6-27-8(25)9(14,11(17,18)19)28-13(23,24)10(15,16)12(20,21)22/h3,7H,1,4-6H2,2H3 |
| InChIKey | HNBWKXLFCSBAFO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|