C17H25Cl2N3O — CID 112504907
3,4-dichloro-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]benzamide (PubChem CID 112504907) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 112504907 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3,4-dichloro-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]benzamide |
| SMILES | CCN1CCN(C(C)(C)CNC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O/c1-4-21-7-9-22(10-8-21)17(2,3)12-20-16(23)13-5-6-14(18)15(19)11-13/h5-6,11H,4,7-10,12H2,1-3H3,(H,20,23) |
| InChIKey | YZZYSASHAJISSG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |