C40H52B2O8 — CID 11250981
(4R,5R)-2-[1-[2-[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolan-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolane (PubChem CID 11250981) has the molecular formula C40H52B2O8 and a molecular weight of 682.47 g/mol. Its IUPAC name is (4R,5R)-2-[1-[2-[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolan-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[1-[2-[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolan-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11250981 |
| Molecular Formula | C40H52B2O8 |
| Molecular Weight | 682.47 g/mol |
| Exact Mass | 682.38 |
| IUPAC Name | (4R,5R)-2-[1-[2-[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolan-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-bis(2-methoxypropan-2-yl)-1,3,2-dioxaborolane |
| SMILES | COC(C)(C)[C@@H]1OB(c2ccc3ccccc3c2-c2c(B3O[C@@H](C(C)(C)OC)[C@H](C(C)(C)OC)O3)ccc3ccccc23)O[C@H]1C(C)(C)OC |
| InChI | InChI=1S/C40H52B2O8/c1-37(2,43-9)33-34(38(3,4)44-10)48-41(47-33)29-23-21-25-17-13-15-19-27(25)31(29)32-28-20-16-14-18-26(28)22-24-30(32)42-49-35(39(5,6)45-11)36(50-42)40(7,8)46-12/h13-24,33-36H,1-12H3/t33-,34-,35-,36-/m1/s1 |
| InChIKey | XJJJQDZETHQPJG-MGXDLYCJSA-N |
| XLogP | 6.32 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|