C28H30B2N2O2 — CID 132539821
2-[1-[2-(5,5-dimethyl-1,3,2-oxazaborolidin-2-yl)naphthalen-1-yl]naphthalen-2-yl]-5,5-dimethyl-1,3,2-oxazaborolidine (PubChem CID 132539821) has the molecular formula C28H30B2N2O2 and a molecular weight of 448.18 g/mol. Its IUPAC name is 2-[1-[2-(5,5-dimethyl-1,3,2-oxazaborolidin-2-yl)naphthalen-1-yl]naphthalen-2-yl]-5,5-dimethyl-1,3,2-oxazaborolidine.
| Compound Name | 2-[1-[2-(5,5-dimethyl-1,3,2-oxazaborolidin-2-yl)naphthalen-1-yl]naphthalen-2-yl]-5,5-dimethyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 132539821 |
| Molecular Formula | C28H30B2N2O2 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[1-[2-(5,5-dimethyl-1,3,2-oxazaborolidin-2-yl)naphthalen-1-yl]naphthalen-2-yl]-5,5-dimethyl-1,3,2-oxazaborolidine |
| SMILES | CC1(C)CNB(c2ccc3ccccc3c2-c2c(B3NCC(C)(C)O3)ccc3ccccc23)O1 |
| InChI | InChI=1S/C28H30B2N2O2/c1-27(2)17-31-29(33-27)23-15-13-19-9-5-7-11-21(19)25(23)26-22-12-8-6-10-20(22)14-16-24(26)30-32-18-28(3,4)34-30/h5-16,31-32H,17-18H2,1-4H3 |
| InChIKey | CFEBLELBOXXFGE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|