C14H15NO — CID 84621824
2,2-dimethyl-1,3-dihydrobenzo[f][1,4]benzoxazine (PubChem CID 84621824) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydrobenzo[f][1,4]benzoxazine.
| Compound Name | 2,2-dimethyl-1,3-dihydrobenzo[f][1,4]benzoxazine |
|---|---|
| PubChem CID | 84621824 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydrobenzo[f][1,4]benzoxazine |
| SMILES | CC1(C)COc2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C14H15NO/c1-14(2)9-16-12-8-7-10-5-3-4-6-11(10)13(12)15-14/h3-8,15H,9H2,1-2H3 |
| InChIKey | NYLPXQUBKNWKIF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |