C48H48O8P2 — CID 11251395
[3-[3-(2,2-dimethylpropanoyloxy)-2-diphenylphosphoryl-6-methoxyphenyl]-2-diphenylphosphoryl-4-methoxyphenyl] 2,2-dimethylpropanoate (PubChem CID 11251395) has the molecular formula C48H48O8P2 and a molecular weight of 814.85 g/mol. Its IUPAC name is [3-[3-(2,2-dimethylpropanoyloxy)-2-diphenylphosphoryl-6-methoxyphenyl]-2-diphenylphosphoryl-4-methoxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[3-(2,2-dimethylpropanoyloxy)-2-diphenylphosphoryl-6-methoxyphenyl]-2-diphenylphosphoryl-4-methoxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11251395 |
| Molecular Formula | C48H48O8P2 |
| Molecular Weight | 814.85 g/mol |
| Exact Mass | 814.28 |
| IUPAC Name | [3-[3-(2,2-dimethylpropanoyloxy)-2-diphenylphosphoryl-6-methoxyphenyl]-2-diphenylphosphoryl-4-methoxyphenyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(OC(=O)C(C)(C)C)c(P(=O)(c2ccccc2)c2ccccc2)c1-c1c(OC)ccc(OC(=O)C(C)(C)C)c1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H48O8P2/c1-47(2,3)45(49)55-39-31-29-37(53-7)41(43(39)57(51,33-21-13-9-14-22-33)34-23-15-10-16-24-34)42-38(54-8)30-32-40(56-46(50)48(4,5)6)44(42)58(52,35-25-17-11-18-26-35)36-27-19-12-20-28-36/h9-32H,1-8H3 |
| InChIKey | OQSQVDMZVSDJHF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.85 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|