2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid

C14H21NO3 — CID 112518821

IUPAC2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid
SMILESCc1ccc(OC(CNC(C)C)C(=O)O)cc1C
InChIInChI=1S/C14H21NO3/c1-9(2)15-8-13(14(16)17)18-12-6-5-10(3)11(4)7-12/h5-7,9,13,15H,8H2,1-4H3,(H,16,17)
InChIKeyKWUZAOUDMZCANR-UHFFFAOYSA-N
MW251.33 g/mol
LogP2.13
Rot. Bonds6

About 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid

2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid (PubChem CID 112518821) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid.

Molecular Properties

Compound Name2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid
PubChem CID112518821
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Name2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid
SMILESCc1ccc(OC(CNC(C)C)C(=O)O)cc1C
InChIInChI=1S/C14H21NO3/c1-9(2)15-8-13(14(16)17)18-12-6-5-10(3)11(4)7-12/h5-7,9,13,15H,8H2,1-4H3,(H,16,17)
InChIKeyKWUZAOUDMZCANR-UHFFFAOYSA-N
XLogP2.13
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid?
The IUPAC name of 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid (CID 112518821) is 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid.
What is the SMILES notation for 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid?
The canonical SMILES for 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid is Cc1ccc(OC(CNC(C)C)C(=O)O)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid?
The InChIKey is KWUZAOUDMZCANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9(2)15-8-13(14(16)17)18-12-6-5-10(3)11(4)7-12/h5-7,9,13,15H,8H2,1-4H3,(H,16,17).
What are the key properties of 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid?
2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid has a molecular weight of 251.33 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenoxy)-3-(propan-2-ylamino)propanoic acid is sourced from PubChem (CID 112518821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).