C19H20N2O5 — CID 112522708
7-amino-3-[3-(3,4-dimethoxyphenyl)-2-methylpropanoyl]-1,3-benzoxazol-2-one (PubChem CID 112522708) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 7-amino-3-[3-(3,4-dimethoxyphenyl)-2-methylpropanoyl]-1,3-benzoxazol-2-one.
| Compound Name | 7-amino-3-[3-(3,4-dimethoxyphenyl)-2-methylpropanoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 112522708 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 7-amino-3-[3-(3,4-dimethoxyphenyl)-2-methylpropanoyl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(CC(C)C(=O)n2c(=O)oc3c(N)cccc32)cc1OC |
| InChI | InChI=1S/C19H20N2O5/c1-11(9-12-7-8-15(24-2)16(10-12)25-3)18(22)21-14-6-4-5-13(20)17(14)26-19(21)23/h4-8,10-11H,9,20H2,1-3H3 |
| InChIKey | WHMOBABSZACCHD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|