C15H14N6O4 — CID 112522834
N-[1-[2-(7-amino-2-oxo-1,3-benzoxazol-3-yl)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide (PubChem CID 112522834) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is N-[1-[2-(7-amino-2-oxo-1,3-benzoxazol-3-yl)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[2-(7-amino-2-oxo-1,3-benzoxazol-3-yl)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 112522834 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[1-[2-(7-amino-2-oxo-1,3-benzoxazol-3-yl)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide |
| SMILES | Nc1cccc2c1oc(=O)n2C(=O)Cn1cc(NC(=O)C2CC2)nn1 |
| InChI | InChI=1S/C15H14N6O4/c16-9-2-1-3-10-13(9)25-15(24)21(10)12(22)7-20-6-11(18-19-20)17-14(23)8-4-5-8/h1-3,6,8H,4-5,7,16H2,(H,17,23) |
| InChIKey | RPZVJCRJGKAWAL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|