C10H10N4O4S — CID 112524285
5-(methylsulfamoyl)-N-pyrimidin-4-ylfuran-2-carboxamide (PubChem CID 112524285) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-pyrimidin-4-ylfuran-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-pyrimidin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112524285 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-(methylsulfamoyl)-N-pyrimidin-4-ylfuran-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccncn2)o1 |
| InChI | InChI=1S/C10H10N4O4S/c1-11-19(16,17)9-3-2-7(18-9)10(15)14-8-4-5-12-6-13-8/h2-6,11H,1H3,(H,12,13,14,15) |
| InChIKey | RCXFXOOTRJRVAO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |