C14H14N4O5 — CID 112535490
ethyl 2-[4-(1,3-benzodioxole-5-carbonylamino)triazol-2-yl]acetate (PubChem CID 112535490) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is ethyl 2-[4-(1,3-benzodioxole-5-carbonylamino)triazol-2-yl]acetate.
| Compound Name | ethyl 2-[4-(1,3-benzodioxole-5-carbonylamino)triazol-2-yl]acetate |
|---|---|
| PubChem CID | 112535490 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | ethyl 2-[4-(1,3-benzodioxole-5-carbonylamino)triazol-2-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc(NC(=O)c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H14N4O5/c1-2-21-13(19)7-18-15-6-12(17-18)16-14(20)9-3-4-10-11(5-9)23-8-22-10/h3-6H,2,7-8H2,1H3,(H,16,17,20) |
| InChIKey | AJWZGQZSYPUKOV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |