C15H18N4O3 — CID 112535556
ethyl 2-[4-[(2,4-dimethylbenzoyl)amino]triazol-1-yl]acetate (PubChem CID 112535556) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl 2-[4-[(2,4-dimethylbenzoyl)amino]triazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(2,4-dimethylbenzoyl)amino]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 112535556 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | ethyl 2-[4-[(2,4-dimethylbenzoyl)amino]triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(NC(=O)c2ccc(C)cc2C)nn1 |
| InChI | InChI=1S/C15H18N4O3/c1-4-22-14(20)9-19-8-13(17-18-19)16-15(21)12-6-5-10(2)7-11(12)3/h5-8H,4,9H2,1-3H3,(H,16,21) |
| InChIKey | FSIVQHGDTQBHPU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |