C13H11F3N4O3 — CID 84582602
ethyl 2-[4-[(2,3,4-trifluorobenzoyl)amino]triazol-1-yl]acetate (PubChem CID 84582602) has the molecular formula C13H11F3N4O3 and a molecular weight of 328.25 g/mol. Its IUPAC name is ethyl 2-[4-[(2,3,4-trifluorobenzoyl)amino]triazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(2,3,4-trifluorobenzoyl)amino]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 84582602 |
| Molecular Formula | C13H11F3N4O3 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | ethyl 2-[4-[(2,3,4-trifluorobenzoyl)amino]triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(NC(=O)c2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C13H11F3N4O3/c1-2-23-10(21)6-20-5-9(18-19-20)17-13(22)7-3-4-8(14)12(16)11(7)15/h3-5H,2,6H2,1H3,(H,17,22) |
| InChIKey | OJCXMBKYMBWHCW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|