C15H18O4 — CID 11254028
methyl (3aS,4R,5R,7aS)-3-oxo-5-[(1E,3E)-penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 11254028) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl (3aS,4R,5R,7aS)-3-oxo-5-[(1E,3E)-penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3aS,4R,5R,7aS)-3-oxo-5-[(1E,3E)-penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 11254028 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (3aS,4R,5R,7aS)-3-oxo-5-[(1E,3E)-penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | C/C=C/C=C/[C@@H]1C=C[C@@H]2COC(=O)[C@@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C15H18O4/c1-3-4-5-6-10-7-8-11-9-19-15(17)13(11)12(10)14(16)18-2/h3-8,10-13H,9H2,1-2H3/b4-3+,6-5+/t10-,11-,12-,13+/m1/s1 |
| InChIKey | HQNPWKPLCUXOAQ-HOSUGSONSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|