C25H42O7Si — CID 101114502
methyl (3aR,4S,5R,7aS)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tri(propan-2-yl)silyloxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 101114502) has the molecular formula C25H42O7Si and a molecular weight of 482.69 g/mol. Its IUPAC name is methyl (3aR,4S,5R,7aS)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tri(propan-2-yl)silyloxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3aR,4S,5R,7aS)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tri(propan-2-yl)silyloxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 101114502 |
| Molecular Formula | C25H42O7Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | methyl (3aR,4S,5R,7aS)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tri(propan-2-yl)silyloxymethyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]([C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]2COC(C)(C)O2)C=C[C@@H]2COC(=O)[C@@H]12 |
| InChI | InChI=1S/C25H42O7Si/c1-14(2)33(15(3)4,16(5)6)32-22(19-13-30-25(7,8)31-19)18-11-10-17-12-29-24(27)20(17)21(18)23(26)28-9/h10-11,14-22H,12-13H2,1-9H3/t17-,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | ADSSCIVKQJOWMT-VXAPCQRLSA-N |
| XLogP | 4.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|