C14H30O4Si — CID 11254791
(2R,3R)-2-[(E)-3-(2-trimethylsilylethoxymethoxy)prop-1-enyl]pentane-1,3-diol (PubChem CID 11254791) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-3-(2-trimethylsilylethoxymethoxy)prop-1-enyl]pentane-1,3-diol.
| Compound Name | (2R,3R)-2-[(E)-3-(2-trimethylsilylethoxymethoxy)prop-1-enyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 11254791 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2R,3R)-2-[(E)-3-(2-trimethylsilylethoxymethoxy)prop-1-enyl]pentane-1,3-diol |
| SMILES | CC[C@@H](O)[C@H](/C=C/COCOCC[Si](C)(C)C)CO |
| InChI | InChI=1S/C14H30O4Si/c1-5-14(16)13(11-15)7-6-8-17-12-18-9-10-19(2,3)4/h6-7,13-16H,5,8-12H2,1-4H3/b7-6+/t13-,14-/m1/s1 |
| InChIKey | BDRZXASRLNENPY-JLVOYYQZSA-N |
| XLogP | 2.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|